About cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol
cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol (PubChem CID 135271530) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol.
Molecular Properties
| Compound Name | cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol |
| PubChem CID | 135271530 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol |
| SMILES | OC(Oc1ccccc1)OC1C=CC=CC1 |
| InChI | InChI=1S/C13H14O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-9,12-14H,10H2 |
| InChIKey | BUPZOSUZAOQCJN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol?
The IUPAC name of cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol (CID 135271530) is cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol.
What is the SMILES notation for cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol?
The canonical SMILES for cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol is OC(Oc1ccccc1)OC1C=CC=CC1.
What is the InChIKey of cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol?
The InChIKey is BUPZOSUZAOQCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-9,12-14H,10H2.
What are the key properties of cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol?
cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol has a molecular weight of 218.25 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-dien-1-yloxy(phenoxy)methanol is sourced from PubChem (CID 135271530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).