C15H22N2 — CID 153400130
(Z,3E)-3-ethylidene-1-phenylhept-4-ene-1,2-diamine (PubChem CID 153400130) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (Z,3E)-3-ethylidene-1-phenylhept-4-ene-1,2-diamine.
| Compound Name | (Z,3E)-3-ethylidene-1-phenylhept-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 153400130 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (Z,3E)-3-ethylidene-1-phenylhept-4-ene-1,2-diamine |
| SMILES | C/C=C(\C=C/CC)C(N)C(N)c1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-3-5-9-12(4-2)14(16)15(17)13-10-7-6-8-11-13/h4-11,14-15H,3,16-17H2,1-2H3/b9-5-,12-4+ |
| InChIKey | IMQJWFVKRXFDPT-WQPWRAGBSA-N |
| XLogP | 2.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|