C15H23S+ — CID 145376903
ethane;[(2E,4Z)-hepta-2,4-dien-3-yl]-phenylsulfanium (PubChem CID 145376903) has the molecular formula C15H23S+ and a molecular weight of 235.42 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hepta-2,4-dien-3-yl]-phenylsulfanium.
| Compound Name | ethane;[(2E,4Z)-hepta-2,4-dien-3-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 145376903 |
| Molecular Formula | C15H23S+ |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | ethane;[(2E,4Z)-hepta-2,4-dien-3-yl]-phenylsulfanium |
| SMILES | C/C=C(\C=C/CC)[SH+]c1ccccc1.CC |
| InChI | InChI=1S/C13H16S.C2H6/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13;1-2/h4-11H,3H2,1-2H3;1-2H3/p+1/b9-5-,12-4+; |
| InChIKey | BKMAMFNBXFNDKN-NFVJVIJNSA-O |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|