C17H17NO — CID 163563011
(Z)-N,N-diphenylpent-2-enamide (PubChem CID 163563011) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (Z)-N,N-diphenylpent-2-enamide.
| Compound Name | (Z)-N,N-diphenylpent-2-enamide |
|---|---|
| PubChem CID | 163563011 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (Z)-N,N-diphenylpent-2-enamide |
| SMILES | CC/C=C\C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO/c1-2-3-14-17(19)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h3-14H,2H2,1H3/b14-3- |
| InChIKey | FSVXQWFTNSKYIM-BNNQUZSASA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|