C20H24N2O2S — CID 91093155
N-[2-[amino(phenyl)methyl]phenyl]hepta-2,4-diene-3-sulfonamide (PubChem CID 91093155) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[2-[amino(phenyl)methyl]phenyl]hepta-2,4-diene-3-sulfonamide.
| Compound Name | N-[2-[amino(phenyl)methyl]phenyl]hepta-2,4-diene-3-sulfonamide |
|---|---|
| PubChem CID | 91093155 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[2-[amino(phenyl)methyl]phenyl]hepta-2,4-diene-3-sulfonamide |
| SMILES | CC=C(C=CCC)S(=O)(=O)Nc1ccccc1C(N)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-3-5-13-17(4-2)25(23,24)22-19-15-10-9-14-18(19)20(21)16-11-7-6-8-12-16/h4-15,20,22H,3,21H2,1-2H3 |
| InChIKey | LLRCYNMDIABTTH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|