C9H12F2N2O2S — CID 43200301
N-[2-(1-aminoethyl)phenyl]-1,1-difluoromethanesulfonamide (PubChem CID 43200301) has the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. Its IUPAC name is N-[2-(1-aminoethyl)phenyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[2-(1-aminoethyl)phenyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 43200301 |
| Molecular Formula | C9H12F2N2O2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-[2-(1-aminoethyl)phenyl]-1,1-difluoromethanesulfonamide |
| SMILES | CC(N)c1ccccc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C9H12F2N2O2S/c1-6(12)7-4-2-3-5-8(7)13-16(14,15)9(10)11/h2-6,9,13H,12H2,1H3 |
| InChIKey | LQKFFMWAJOSAJL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |