C10H13F2N3O3S — CID 107000097
N-(2-aminoethyl)-2-(difluoromethylsulfonylamino)benzamide (PubChem CID 107000097) has the molecular formula C10H13F2N3O3S and a molecular weight of 293.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(difluoromethylsulfonylamino)benzamide.
| Compound Name | N-(2-aminoethyl)-2-(difluoromethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 107000097 |
| Molecular Formula | C10H13F2N3O3S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(2-aminoethyl)-2-(difluoromethylsulfonylamino)benzamide |
| SMILES | NCCNC(=O)c1ccccc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H13F2N3O3S/c11-10(12)19(17,18)15-8-4-2-1-3-7(8)9(16)14-6-5-13/h1-4,10,15H,5-6,13H2,(H,14,16) |
| InChIKey | ICMYIWQIXFOICB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |