C14H14BrN3O2S — CID 107143415
N-[2-(2-aminoethylcarbamoyl)phenyl]-5-bromothiophene-3-carboxamide (PubChem CID 107143415) has the molecular formula C14H14BrN3O2S and a molecular weight of 368.26 g/mol. Its IUPAC name is N-[2-(2-aminoethylcarbamoyl)phenyl]-5-bromothiophene-3-carboxamide.
| Compound Name | N-[2-(2-aminoethylcarbamoyl)phenyl]-5-bromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107143415 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-[2-(2-aminoethylcarbamoyl)phenyl]-5-bromothiophene-3-carboxamide |
| SMILES | NCCNC(=O)c1ccccc1NC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C14H14BrN3O2S/c15-12-7-9(8-21-12)13(19)18-11-4-2-1-3-10(11)14(20)17-6-5-16/h1-4,7-8H,5-6,16H2,(H,17,20)(H,18,19) |
| InChIKey | NFDGLPRNDOOZJP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |