C17H17BrN2O2S — CID 37079607
5-bromo-N-[2-(piperidine-1-carbonyl)phenyl]thiophene-3-carboxamide (PubChem CID 37079607) has the molecular formula C17H17BrN2O2S and a molecular weight of 393.31 g/mol. Its IUPAC name is 5-bromo-N-[2-(piperidine-1-carbonyl)phenyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(piperidine-1-carbonyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 37079607 |
| Molecular Formula | C17H17BrN2O2S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 5-bromo-N-[2-(piperidine-1-carbonyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCCCC1)c1csc(Br)c1 |
| InChI | InChI=1S/C17H17BrN2O2S/c18-15-10-12(11-23-15)16(21)19-14-7-3-2-6-13(14)17(22)20-8-4-1-5-9-20/h2-3,6-7,10-11H,1,4-5,8-9H2,(H,19,21) |
| InChIKey | QNMFHTQQNXFYDK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |