C12H15F3N4O2 — CID 107000067
N-(2-aminoethyl)-2-(2,2,2-trifluoroethylcarbamoylamino)benzamide (PubChem CID 107000067) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(2,2,2-trifluoroethylcarbamoylamino)benzamide.
| Compound Name | N-(2-aminoethyl)-2-(2,2,2-trifluoroethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 107000067 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(2-aminoethyl)-2-(2,2,2-trifluoroethylcarbamoylamino)benzamide |
| SMILES | NCCNC(=O)c1ccccc1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O2/c13-12(14,15)7-18-11(21)19-9-4-2-1-3-8(9)10(20)17-6-5-16/h1-4H,5-7,16H2,(H,17,20)(H2,18,19,21) |
| InChIKey | OBILZVLDTSMSJG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |