C14H16F3N3O3 — CID 95625392
2-[[(2R)-2-acetamidopropanoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 95625392) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-[[(2R)-2-acetamidopropanoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[(2R)-2-acetamidopropanoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 95625392 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[[(2R)-2-acetamidopropanoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(=O)N[C@H](C)C(=O)Nc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O3/c1-8(19-9(2)21)12(22)20-11-6-4-3-5-10(11)13(23)18-7-14(15,16)17/h3-6,8H,7H2,1-2H3,(H,18,23)(H,19,21)(H,20,22)/t8-/m1/s1 |
| InChIKey | LFNRCKGOBBLUDI-MRVPVSSYSA-N |
| XLogP | 1.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |