C18H18F3N3O2 — CID 35966446
2-[[3-(dimethylamino)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 35966446) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-[[3-(dimethylamino)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[3-(dimethylamino)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 35966446 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[[3-(dimethylamino)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CN(C)c1cccc(C(=O)Nc2ccccc2C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3N3O2/c1-24(2)13-7-5-6-12(10-13)16(25)23-15-9-4-3-8-14(15)17(26)22-11-18(19,20)21/h3-10H,11H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | FDHKVHAJRFVOIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |