C15H11ClF3N3O2 — CID 36661694
6-chloro-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide (PubChem CID 36661694) has the molecular formula C15H11ClF3N3O2 and a molecular weight of 357.72 g/mol. Its IUPAC name is 6-chloro-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 36661694 |
| Molecular Formula | C15H11ClF3N3O2 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 6-chloro-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCC(F)(F)F)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H11ClF3N3O2/c16-12-6-5-9(7-20-12)13(23)22-11-4-2-1-3-10(11)14(24)21-8-15(17,18)19/h1-7H,8H2,(H,21,24)(H,22,23) |
| InChIKey | GBPRBYZDSCQQMY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|