C14H10ClF3N2O2 — CID 41369460
6-chloro-N-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 41369460) has the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. Its IUPAC name is 6-chloro-N-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 41369460 |
| Molecular Formula | C14H10ClF3N2O2 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 6-chloro-N-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1OCC(F)(F)F)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H10ClF3N2O2/c15-12-6-5-9(7-19-12)13(21)20-10-3-1-2-4-11(10)22-8-14(16,17)18/h1-7H,8H2,(H,20,21) |
| InChIKey | LNKOAKJHBFTDNA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|