C10H17ClN2O2S — CID 142689646
N-[3-[(1R)-1-aminoethyl]-2-methylphenyl]methanesulfonamide;hydrochloride (PubChem CID 142689646) has the molecular formula C10H17ClN2O2S and a molecular weight of 264.78 g/mol. Its IUPAC name is N-[3-[(1R)-1-aminoethyl]-2-methylphenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[3-[(1R)-1-aminoethyl]-2-methylphenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 142689646 |
| Molecular Formula | C10H17ClN2O2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[3-[(1R)-1-aminoethyl]-2-methylphenyl]methanesulfonamide;hydrochloride |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1[C@@H](C)N.Cl |
| InChI | InChI=1S/C10H16N2O2S.ClH/c1-7-9(8(2)11)5-4-6-10(7)12-15(3,13)14;/h4-6,8,12H,11H2,1-3H3;1H/t8-;/m1./s1 |
| InChIKey | LJOBYPCAQIEQBH-DDWIOCJRSA-N |
| XLogP | 1.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |