C21H24FeO7 — CID 11826386
carbon monoxide;(3S,6E,8E)-3-hydroxy-1-[(2-methoxyphenyl)methoxy]deca-6,8-dien-5-one;iron (PubChem CID 11826386) has the molecular formula C21H24FeO7 and a molecular weight of 444.26 g/mol. Its IUPAC name is carbon monoxide;(3S,6E,8E)-3-hydroxy-1-[(2-methoxyphenyl)methoxy]deca-6,8-dien-5-one;iron.
| Compound Name | carbon monoxide;(3S,6E,8E)-3-hydroxy-1-[(2-methoxyphenyl)methoxy]deca-6,8-dien-5-one;iron |
|---|---|
| PubChem CID | 11826386 |
| Molecular Formula | C21H24FeO7 |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | carbon monoxide;(3S,6E,8E)-3-hydroxy-1-[(2-methoxyphenyl)methoxy]deca-6,8-dien-5-one;iron |
| SMILES | C/C=C/C=C/C(=O)C[C@@H](O)CCOCc1ccccc1OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C18H24O4.3CO.Fe/c1-3-4-5-9-16(19)13-17(20)11-12-22-14-15-8-6-7-10-18(15)21-2;3*1-2;/h3-10,17,20H,11-14H2,1-2H3;;;;/b4-3+,9-5+;;;;/t17-;;;;/m0..../s1 |
| InChIKey | GEDGCYTZDZWDKB-OPPMUPEUSA-N |
| XLogP | 2.94 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|