C28H36O5S3 — CID 134982160
(2S,6S)-3-(benzenesulfonyl)-2-(1,3-dithian-2-yl)-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyloct-7-en-4-one (PubChem CID 134982160) has the molecular formula C28H36O5S3 and a molecular weight of 548.79 g/mol. Its IUPAC name is (2S,6S)-3-(benzenesulfonyl)-2-(1,3-dithian-2-yl)-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyloct-7-en-4-one.
| Compound Name | (2S,6S)-3-(benzenesulfonyl)-2-(1,3-dithian-2-yl)-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyloct-7-en-4-one |
|---|---|
| PubChem CID | 134982160 |
| Molecular Formula | C28H36O5S3 |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | (2S,6S)-3-(benzenesulfonyl)-2-(1,3-dithian-2-yl)-6-[(4-methoxyphenyl)methoxy]-5,5-dimethyloct-7-en-4-one |
| SMILES | C=C[C@H](OCc1ccc(OC)cc1)C(C)(C)C(=O)C([C@H](C)C1SCCCS1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H36O5S3/c1-6-24(33-19-21-13-15-22(32-5)16-14-21)28(3,4)26(29)25(20(2)27-34-17-10-18-35-27)36(30,31)23-11-8-7-9-12-23/h6-9,11-16,20,24-25,27H,1,10,17-19H2,2-5H3/t20-,24-,25?/m0/s1 |
| InChIKey | HGVOROFPNGMOOA-RRDJUMLSSA-N |
| XLogP | 6.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|