C19H22O4S — CID 102177081
(1S,2R)-2-(benzenesulfonylmethyl)-1-(4-methoxyphenyl)-2-methylbut-3-en-1-ol (PubChem CID 102177081) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (1S,2R)-2-(benzenesulfonylmethyl)-1-(4-methoxyphenyl)-2-methylbut-3-en-1-ol.
| Compound Name | (1S,2R)-2-(benzenesulfonylmethyl)-1-(4-methoxyphenyl)-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 102177081 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1S,2R)-2-(benzenesulfonylmethyl)-1-(4-methoxyphenyl)-2-methylbut-3-en-1-ol |
| SMILES | C=C[C@@](C)(CS(=O)(=O)c1ccccc1)[C@@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22O4S/c1-4-19(2,14-24(21,22)17-8-6-5-7-9-17)18(20)15-10-12-16(23-3)13-11-15/h4-13,18,20H,1,14H2,2-3H3/t18-,19-/m0/s1 |
| InChIKey | YAMAEQZBCGDHJX-OALUTQOASA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|