C18H28O2 — CID 123339155
1-(2,6-dimethyloct-7-en-2-yloxymethyl)-4-methoxybenzene (PubChem CID 123339155) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(2,6-dimethyloct-7-en-2-yloxymethyl)-4-methoxybenzene.
| Compound Name | 1-(2,6-dimethyloct-7-en-2-yloxymethyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 123339155 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-(2,6-dimethyloct-7-en-2-yloxymethyl)-4-methoxybenzene |
| SMILES | C=CC(C)CCCC(C)(C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28O2/c1-6-15(2)8-7-13-18(3,4)20-14-16-9-11-17(19-5)12-10-16/h6,9-12,15H,1,7-8,13-14H2,2-5H3 |
| InChIKey | GHGQKWWRSLMXPX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|