About 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene
1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene (PubChem CID 16753810) has the molecular formula C17H22Br2O2
and a molecular weight of 418.17 g/mol. Its IUPAC name is 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene.
Molecular Properties
| Compound Name | 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene |
| PubChem CID | 16753810 |
| Molecular Formula | C17H22Br2O2 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene |
| SMILES | C=CCC[C@@](C)(CC=C(Br)Br)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H22Br2O2/c1-4-5-11-17(2,12-10-16(18)19)21-13-14-6-8-15(20-3)9-7-14/h4,6-10H,1,5,11-13H2,2-3H3/t17-/m0/s1 |
| InChIKey | VVTISRQOBNSBPW-KRWDZBQOSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene?
The IUPAC name of 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene (CID 16753810) is 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene.
What is the SMILES notation for 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene?
The canonical SMILES for 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene is C=CCC[C@@](C)(CC=C(Br)Br)OCc1ccc(OC)cc1.
What is the InChIKey of 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene?
The InChIKey is VVTISRQOBNSBPW-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H22Br2O2/c1-4-5-11-17(2,12-10-16(18)19)21-13-14-6-8-15(20-3)9-7-14/h4,6-10H,1,5,11-13H2,2-3H3/t17-/m0/s1.
What are the key properties of 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene?
1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene has a molecular weight of 418.17 g/mol, XLogP of 5.96, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4S)-1,1-dibromo-4-methylocta-1,7-dien-4-yl]oxymethyl]-4-methoxybenzene is sourced from PubChem (CID 16753810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).