C16H22O3 — CID 102289994
5-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-3-yn-2-ol (PubChem CID 102289994) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-3-yn-2-ol.
| Compound Name | 5-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-3-yn-2-ol |
|---|---|
| PubChem CID | 102289994 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 5-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-3-yn-2-ol |
| SMILES | COc1ccc(COC(C)(C)C#CC(C)(C)O)cc1 |
| InChI | InChI=1S/C16H22O3/c1-15(2,17)10-11-16(3,4)19-12-13-6-8-14(18-5)9-7-13/h6-9,17H,12H2,1-5H3 |
| InChIKey | RPIGLGDFVTYMEE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|