C14H22O2 — CID 79444953
1-(4-methoxyphenyl)-2,3-dimethylpentan-2-ol (PubChem CID 79444953) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,3-dimethylpentan-2-ol.
| Compound Name | 1-(4-methoxyphenyl)-2,3-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 79444953 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,3-dimethylpentan-2-ol |
| SMILES | CCC(C)C(C)(O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H22O2/c1-5-11(2)14(3,15)10-12-6-8-13(16-4)9-7-12/h6-9,11,15H,5,10H2,1-4H3 |
| InChIKey | YMFLPOQKBCWABW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |