C14H19F3O — CID 65147130
2,3-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 65147130) has the molecular formula C14H19F3O and a molecular weight of 260.30 g/mol. Its IUPAC name is 2,3-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | 2,3-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 65147130 |
| Molecular Formula | C14H19F3O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,3-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | CCC(C)C(C)(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O/c1-4-10(2)13(3,18)9-11-5-7-12(8-6-11)14(15,16)17/h5-8,10,18H,4,9H2,1-3H3 |
| InChIKey | ZBPYXQUTBIHCOQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |