C16H21F3O — CID 63833110
4,5,5-trimethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-one (PubChem CID 63833110) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is 4,5,5-trimethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-one.
| Compound Name | 4,5,5-trimethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-one |
|---|---|
| PubChem CID | 63833110 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4,5,5-trimethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-one |
| SMILES | CC(CC(=O)Cc1ccc(C(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H21F3O/c1-11(15(2,3)4)9-14(20)10-12-5-7-13(8-6-12)16(17,18)19/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | GOKBJPLJEYSCHD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |