C12H13ClF3NO — CID 113271516
N-(2-chloropropyl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 113271516) has the molecular formula C12H13ClF3NO and a molecular weight of 279.69 g/mol. Its IUPAC name is N-(2-chloropropyl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2-chloropropyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113271516 |
| Molecular Formula | C12H13ClF3NO |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-(2-chloropropyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(Cl)CNC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13ClF3NO/c1-8(13)7-17-11(18)6-9-2-4-10(5-3-9)12(14,15)16/h2-5,8H,6-7H2,1H3,(H,17,18) |
| InChIKey | AMLJXJDOVYKBNY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|