C16H22F3NO — CID 116614647
4-amino-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-one (PubChem CID 116614647) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-amino-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-one.
| Compound Name | 4-amino-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-one |
|---|---|
| PubChem CID | 116614647 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-amino-6,6-dimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-one |
| SMILES | CC(C)(C)CC(N)CC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO/c1-15(2,3)10-13(20)9-14(21)8-11-4-6-12(7-5-11)16(17,18)19/h4-7,13H,8-10,20H2,1-3H3 |
| InChIKey | DNNGNQDMCWMVKD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |