C26H42Br2O3Si — CID 11082509
tert-butyl-[(5R)-5-[(1S)-3,3-dibromo-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]non-1-en-5-yl]oxy-dimethylsilane (PubChem CID 11082509) has the molecular formula C26H42Br2O3Si and a molecular weight of 590.51 g/mol. Its IUPAC name is tert-butyl-[(5R)-5-[(1S)-3,3-dibromo-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]non-1-en-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5R)-5-[(1S)-3,3-dibromo-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]non-1-en-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11082509 |
| Molecular Formula | C26H42Br2O3Si |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | tert-butyl-[(5R)-5-[(1S)-3,3-dibromo-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]non-1-en-5-yl]oxy-dimethylsilane |
| SMILES | C=CCC[C@@](CCCC)(O[Si](C)(C)C(C)(C)C)[C@H](C=C(Br)Br)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H42Br2O3Si/c1-9-11-17-26(18-12-10-2,31-32(7,8)25(3,4)5)23(19-24(27)28)30-20-21-13-15-22(29-6)16-14-21/h9,13-16,19,23H,1,10-12,17-18,20H2,2-8H3/t23-,26-/m0/s1 |
| InChIKey | AZJHPBJPKBNXQT-OZXSUGGESA-N |
| XLogP | 9.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|