C18H28O5 — CID 71606468
(2R,3S)-6-[(4-methoxyphenyl)methoxy]-3-methyl-3-prop-2-enoxyhexane-1,2-diol (PubChem CID 71606468) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2R,3S)-6-[(4-methoxyphenyl)methoxy]-3-methyl-3-prop-2-enoxyhexane-1,2-diol.
| Compound Name | (2R,3S)-6-[(4-methoxyphenyl)methoxy]-3-methyl-3-prop-2-enoxyhexane-1,2-diol |
|---|---|
| PubChem CID | 71606468 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2R,3S)-6-[(4-methoxyphenyl)methoxy]-3-methyl-3-prop-2-enoxyhexane-1,2-diol |
| SMILES | C=CCO[C@@](C)(CCCOCc1ccc(OC)cc1)[C@H](O)CO |
| InChI | InChI=1S/C18H28O5/c1-4-11-23-18(2,17(20)13-19)10-5-12-22-14-15-6-8-16(21-3)9-7-15/h4,6-9,17,19-20H,1,5,10-14H2,2-3H3/t17-,18+/m1/s1 |
| InChIKey | YHDAYXDZEVADQW-MSOLQXFVSA-N |
| XLogP | 2.31 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|