C21H26O7 — CID 174667133
(2R,3R,4R,5R)-4,5,6-trihydroxy-3-[(4-methoxyphenyl)methoxy]-2-phenylmethoxyhexanal (PubChem CID 174667133) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4,5,6-trihydroxy-3-[(4-methoxyphenyl)methoxy]-2-phenylmethoxyhexanal.
| Compound Name | (2R,3R,4R,5R)-4,5,6-trihydroxy-3-[(4-methoxyphenyl)methoxy]-2-phenylmethoxyhexanal |
|---|---|
| PubChem CID | 174667133 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2R,3R,4R,5R)-4,5,6-trihydroxy-3-[(4-methoxyphenyl)methoxy]-2-phenylmethoxyhexanal |
| SMILES | COc1ccc(CO[C@H]([C@H](O)[C@H](O)CO)[C@H](C=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26O7/c1-26-17-9-7-16(8-10-17)14-28-21(20(25)18(24)11-22)19(12-23)27-13-15-5-3-2-4-6-15/h2-10,12,18-22,24-25H,11,13-14H2,1H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | VCQWKRFDGAMHPW-MHTWAQMVSA-N |
| XLogP | 1.08 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|