C13H16O5 — CID 15235480
(2R,3R,4S)-3-hydroxy-2-(hydroxymethyl)-4-phenylmethoxypentanedial (PubChem CID 15235480) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2R,3R,4S)-3-hydroxy-2-(hydroxymethyl)-4-phenylmethoxypentanedial.
| Compound Name | (2R,3R,4S)-3-hydroxy-2-(hydroxymethyl)-4-phenylmethoxypentanedial |
|---|---|
| PubChem CID | 15235480 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (2R,3R,4S)-3-hydroxy-2-(hydroxymethyl)-4-phenylmethoxypentanedial |
| SMILES | O=C[C@H](CO)[C@@H](O)[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16O5/c14-6-11(7-15)13(17)12(8-16)18-9-10-4-2-1-3-5-10/h1-6,8,11-13,15,17H,7,9H2/t11-,12-,13-/m1/s1 |
| InChIKey | ZFHUBTKXIASEGG-JHJVBQTASA-N |
| XLogP | -0.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|