C15H20O6 — CID 102041193
(2R,3R,4R)-3,4,7-trihydroxy-6-methyl-5-oxo-2-phenylmethoxyheptanal (PubChem CID 102041193) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2R,3R,4R)-3,4,7-trihydroxy-6-methyl-5-oxo-2-phenylmethoxyheptanal.
| Compound Name | (2R,3R,4R)-3,4,7-trihydroxy-6-methyl-5-oxo-2-phenylmethoxyheptanal |
|---|---|
| PubChem CID | 102041193 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2R,3R,4R)-3,4,7-trihydroxy-6-methyl-5-oxo-2-phenylmethoxyheptanal |
| SMILES | CC(CO)C(=O)[C@H](O)[C@@H](O)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20O6/c1-10(7-16)13(18)15(20)14(19)12(8-17)21-9-11-5-3-2-4-6-11/h2-6,8,10,12,14-16,19-20H,7,9H2,1H3/t10?,12-,14-,15-/m0/s1 |
| InChIKey | DPLMWIFOLTZFEU-ZRZIZSTPSA-N |
| XLogP | -0.31 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|