C20H22O4 — CID 11313391
(E,2S,3R)-5-methoxy-2,3-bis(phenylmethoxy)pent-4-enal (PubChem CID 11313391) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (E,2S,3R)-5-methoxy-2,3-bis(phenylmethoxy)pent-4-enal.
| Compound Name | (E,2S,3R)-5-methoxy-2,3-bis(phenylmethoxy)pent-4-enal |
|---|---|
| PubChem CID | 11313391 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (E,2S,3R)-5-methoxy-2,3-bis(phenylmethoxy)pent-4-enal |
| SMILES | CO/C=C/[C@@H](OCc1ccccc1)[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22O4/c1-22-13-12-19(23-15-17-8-4-2-5-9-17)20(14-21)24-16-18-10-6-3-7-11-18/h2-14,19-20H,15-16H2,1H3/b13-12+/t19-,20-/m1/s1 |
| InChIKey | MDGLFMCHIVJSRU-OKLSWEBGSA-N |
| XLogP | 3.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|