C20H22O5 — CID 162398518
[(2S,3R)-2-[(4-methoxyphenyl)methoxy]-1-oxo-5-phenylpentan-3-yl] formate (PubChem CID 162398518) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2S,3R)-2-[(4-methoxyphenyl)methoxy]-1-oxo-5-phenylpentan-3-yl] formate.
| Compound Name | [(2S,3R)-2-[(4-methoxyphenyl)methoxy]-1-oxo-5-phenylpentan-3-yl] formate |
|---|---|
| PubChem CID | 162398518 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [(2S,3R)-2-[(4-methoxyphenyl)methoxy]-1-oxo-5-phenylpentan-3-yl] formate |
| SMILES | COc1ccc(CO[C@H](C=O)[C@@H](CCc2ccccc2)OC=O)cc1 |
| InChI | InChI=1S/C20H22O5/c1-23-18-10-7-17(8-11-18)14-24-20(13-21)19(25-15-22)12-9-16-5-3-2-4-6-16/h2-8,10-11,13,15,19-20H,9,12,14H2,1H3/t19-,20-/m1/s1 |
| InChIKey | JPIWHSLIRICWNE-WOJBJXKFSA-N |
| XLogP | 2.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|