C30H34O6 — CID 23643610
ethyl (4S,5R)-5-[(4-methoxyphenyl)methoxy]-3-oxo-7-phenyl-4-phenylmethoxyheptanoate (PubChem CID 23643610) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl (4S,5R)-5-[(4-methoxyphenyl)methoxy]-3-oxo-7-phenyl-4-phenylmethoxyheptanoate.
| Compound Name | ethyl (4S,5R)-5-[(4-methoxyphenyl)methoxy]-3-oxo-7-phenyl-4-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 23643610 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl (4S,5R)-5-[(4-methoxyphenyl)methoxy]-3-oxo-7-phenyl-4-phenylmethoxyheptanoate |
| SMILES | CCOC(=O)CC(=O)[C@@H](OCc1ccccc1)[C@@H](CCc1ccccc1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H34O6/c1-3-34-29(32)20-27(31)30(36-22-24-12-8-5-9-13-24)28(19-16-23-10-6-4-7-11-23)35-21-25-14-17-26(33-2)18-15-25/h4-15,17-18,28,30H,3,16,19-22H2,1-2H3/t28-,30-/m1/s1 |
| InChIKey | PXJQGHDHGNAPAT-PQHLKRTFSA-N |
| XLogP | 5.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|