C38H52O8 — CID 11192998
(4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-[(4S,6R)-6-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]oct-7-yn-2-one (PubChem CID 11192998) has the molecular formula C38H52O8 and a molecular weight of 636.83 g/mol. Its IUPAC name is (4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-[(4S,6R)-6-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]oct-7-yn-2-one.
| Compound Name | (4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-[(4S,6R)-6-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]oct-7-yn-2-one |
|---|---|
| PubChem CID | 11192998 |
| Molecular Formula | C38H52O8 |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.37 |
| IUPAC Name | (4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-[(4S,6R)-6-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]oct-7-yn-2-one |
| SMILES | C#C[C@H](C[C@H](O)CC(=O)C[C@@H]1C[C@H](/C=C/[C@H](C)[C@@H](OCc2ccc(OC)cc2)C(C)C)OC(C)(C)O1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C38H52O8/c1-9-32(43-24-28-11-16-33(41-7)17-12-28)21-30(39)20-31(40)22-36-23-35(45-38(5,6)46-36)15-10-27(4)37(26(2)3)44-25-29-13-18-34(42-8)19-14-29/h1,10-19,26-27,30,32,35-37,39H,20-25H2,2-8H3/b15-10+/t27-,30+,32+,35-,36+,37-/m0/s1 |
| InChIKey | LOVUIJXWIBJUGU-OAQQVWGDSA-N |
| XLogP | 6.67 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|