C15H20O4 — CID 11254081
(3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol (PubChem CID 11254081) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol.
| Compound Name | (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol |
|---|---|
| PubChem CID | 11254081 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol |
| SMILES | C#C[C@@H](C[C@H](O)CCO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O4/c1-3-14(10-13(17)8-9-16)19-11-12-4-6-15(18-2)7-5-12/h1,4-7,13-14,16-17H,8-11H2,2H3/t13-,14+/m1/s1 |
| InChIKey | QAPWQMFYCFEHQD-KGLIPLIRSA-N |
| XLogP | 1.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|