About (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol
(3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol (PubChem CID 11254081) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol.
Molecular Properties
| Compound Name | (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol |
| PubChem CID | 11254081 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol |
| SMILES | C#C[C@@H](C[C@H](O)CCO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O4/c1-3-14(10-13(17)8-9-16)19-11-12-4-6-15(18-2)7-5-12/h1,4-7,13-14,16-17H,8-11H2,2H3/t13-,14+/m1/s1 |
| InChIKey | QAPWQMFYCFEHQD-KGLIPLIRSA-N |
| XLogP | 1.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol?
The IUPAC name of (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol (CID 11254081) is (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol.
What is the SMILES notation for (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol?
The canonical SMILES for (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol is C#C[C@@H](C[C@H](O)CCO)OCc1ccc(OC)cc1.
What is the InChIKey of (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol?
The InChIKey is QAPWQMFYCFEHQD-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H20O4/c1-3-14(10-13(17)8-9-16)19-11-12-4-6-15(18-2)7-5-12/h1,4-7,13-14,16-17H,8-11H2,2H3/t13-,14+/m1/s1.
What are the key properties of (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol?
(3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol has a molecular weight of 264.32 g/mol, XLogP of 1.35, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-yne-1,3-diol is sourced from PubChem (CID 11254081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).