C26H38O5 — CID 11774764
2-[(7S,9R)-9-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-6,10-dioxaspiro[4.5]decan-7-yl]acetaldehyde (PubChem CID 11774764) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[(7S,9R)-9-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-6,10-dioxaspiro[4.5]decan-7-yl]acetaldehyde.
| Compound Name | 2-[(7S,9R)-9-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-6,10-dioxaspiro[4.5]decan-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 11774764 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-[(7S,9R)-9-[(E,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3,5-dimethylhex-1-enyl]-6,10-dioxaspiro[4.5]decan-7-yl]acetaldehyde |
| SMILES | COc1ccc(CO[C@@H](C(C)C)[C@@H](C)/C=C/[C@H]2C[C@@H](CC=O)OC3(CCCC3)O2)cc1 |
| InChI | InChI=1S/C26H38O5/c1-19(2)25(29-18-21-8-11-22(28-4)12-9-21)20(3)7-10-23-17-24(13-16-27)31-26(30-23)14-5-6-15-26/h7-12,16,19-20,23-25H,5-6,13-15,17-18H2,1-4H3/b10-7+/t20-,23-,24+,25-/m0/s1 |
| InChIKey | CKPCDZTVIIZLRY-WVOHDJDKSA-N |
| XLogP | 5.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|