C31H38O8 — CID 102278627
(2R)-2-[(Z,3R)-3-[(4-methoxyphenyl)methoxy]-3-[(4R,5S)-5-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 102278627) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is (2R)-2-[(Z,3R)-3-[(4-methoxyphenyl)methoxy]-3-[(4R,5S)-5-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(Z,3R)-3-[(4-methoxyphenyl)methoxy]-3-[(4R,5S)-5-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 102278627 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (2R)-2-[(Z,3R)-3-[(4-methoxyphenyl)methoxy]-3-[(4R,5S)-5-[(1S)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | COc1ccc(CO[C@@H](C)[C@@H]2OC(C)(C)O[C@@H]2[C@@H](/C=C\[C@H]2CC=CC(=O)O2)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H38O8/c1-21(35-19-22-9-13-24(33-4)14-10-22)29-30(39-31(2,3)38-29)27(18-17-26-7-6-8-28(32)37-26)36-20-23-11-15-25(34-5)16-12-23/h6,8-18,21,26-27,29-30H,7,19-20H2,1-5H3/b18-17-/t21-,26+,27+,29-,30+/m0/s1 |
| InChIKey | ARPTZOZCBWCDNP-KRHCDWIUSA-N |
| XLogP | 5.14 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|