C27H28O5 — CID 10788908
(2S,3S,4R,5S)-5-deuterio-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde (PubChem CID 10788908) has the molecular formula C27H28O5 and a molecular weight of 433.52 g/mol. Its IUPAC name is (2S,3S,4R,5S)-5-deuterio-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde.
| Compound Name | (2S,3S,4R,5S)-5-deuterio-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 10788908 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (2S,3S,4R,5S)-5-deuterio-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde |
| SMILES | [2H][C@@]1(COCc2ccccc2)O[C@H](C=O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O5/c28-16-24-26(30-18-22-12-6-2-7-13-22)27(31-19-23-14-8-3-9-15-23)25(32-24)20-29-17-21-10-4-1-5-11-21/h1-16,24-27H,17-20H2/t24-,25+,26-,27-/m1/s1/i25D |
| InChIKey | FHNGZJPNWWCNKW-AJXICSRMSA-N |
| XLogP | 4.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|