C15H20O3 — CID 15881326
[(2R,3S)-3-[(E)-5-phenylmethoxypent-2-en-2-yl]oxiran-2-yl]methanol (PubChem CID 15881326) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is [(2R,3S)-3-[(E)-5-phenylmethoxypent-2-en-2-yl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-[(E)-5-phenylmethoxypent-2-en-2-yl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 15881326 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(2R,3S)-3-[(E)-5-phenylmethoxypent-2-en-2-yl]oxiran-2-yl]methanol |
| SMILES | C/C(=C\CCOCc1ccccc1)[C@@H]1O[C@@H]1CO |
| InChI | InChI=1S/C15H20O3/c1-12(15-14(10-16)18-15)6-5-9-17-11-13-7-3-2-4-8-13/h2-4,6-8,14-16H,5,9-11H2,1H3/b12-6+/t14-,15+/m1/s1 |
| InChIKey | ZNWASZBVAHUKSZ-KOHOMEMWSA-N |
| XLogP | 2.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|