C14H16O2P+ — CID 91013313
1,1'-biphenyl;methoxy-methyl-oxophosphanium (PubChem CID 91013313) has the molecular formula C14H16O2P+ and a molecular weight of 247.25 g/mol. Its IUPAC name is 1,1'-biphenyl;methoxy-methyl-oxophosphanium.
| Compound Name | 1,1'-biphenyl;methoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 91013313 |
| Molecular Formula | C14H16O2P+ |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1,1'-biphenyl;methoxy-methyl-oxophosphanium |
| SMILES | CO[P+](C)=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H6O2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-5(2)3/h1-10H;1-2H3/q;+1 |
| InChIKey | HBUAEMKIPFTLNH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|