C37H30O6 — CID 132820007
trimethyl 2,4,6,7-tetraphenylcyclohepta-1,4,6-triene-1,3,5-tricarboxylate (PubChem CID 132820007) has the molecular formula C37H30O6 and a molecular weight of 570.64 g/mol. Its IUPAC name is trimethyl 2,4,6,7-tetraphenylcyclohepta-1,4,6-triene-1,3,5-tricarboxylate.
| Compound Name | trimethyl 2,4,6,7-tetraphenylcyclohepta-1,4,6-triene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 132820007 |
| Molecular Formula | C37H30O6 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | trimethyl 2,4,6,7-tetraphenylcyclohepta-1,4,6-triene-1,3,5-tricarboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)C(C(=O)OC)C(c2ccccc2)=C(C(=O)OC)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C37H30O6/c1-41-35(38)32-28(24-16-8-4-9-17-24)29(25-18-10-5-11-19-25)33(36(39)42-2)31(27-22-14-7-15-23-27)34(37(40)43-3)30(32)26-20-12-6-13-21-26/h4-23,34H,1-3H3 |
| InChIKey | NDLLWBMGBPYDDR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|