C26H20O3 — CID 11610608
methyl (1R,4S)-3,5,6-triphenyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 11610608) has the molecular formula C26H20O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl (1R,4S)-3,5,6-triphenyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | methyl (1R,4S)-3,5,6-triphenyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 11610608 |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl (1R,4S)-3,5,6-triphenyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)[C@H]2O[C@@H]1C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C26H20O3/c1-28-26(27)23-22(19-15-9-4-10-16-19)24-20(17-11-5-2-6-12-17)21(25(23)29-24)18-13-7-3-8-14-18/h2-16,24-25H,1H3/t24-,25+/m0/s1 |
| InChIKey | DQFDRBFVIQWNDY-LOSJGSFVSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|