C21H16I2O5 — CID 102593093
dimethyl 3-iodo-2-(4-iodophenyl)-4-phenyl-2H-pyran-5,6-dicarboxylate (PubChem CID 102593093) has the molecular formula C21H16I2O5 and a molecular weight of 602.16 g/mol. Its IUPAC name is dimethyl 3-iodo-2-(4-iodophenyl)-4-phenyl-2H-pyran-5,6-dicarboxylate.
| Compound Name | dimethyl 3-iodo-2-(4-iodophenyl)-4-phenyl-2H-pyran-5,6-dicarboxylate |
|---|---|
| PubChem CID | 102593093 |
| Molecular Formula | C21H16I2O5 |
| Molecular Weight | 602.16 g/mol |
| Exact Mass | 601.91 |
| IUPAC Name | dimethyl 3-iodo-2-(4-iodophenyl)-4-phenyl-2H-pyran-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)=C(I)C(c2ccc(I)cc2)O1 |
| InChI | InChI=1S/C21H16I2O5/c1-26-20(24)16-15(12-6-4-3-5-7-12)17(23)18(28-19(16)21(25)27-2)13-8-10-14(22)11-9-13/h3-11,18H,1-2H3 |
| InChIKey | QIKSJMQNNBJDBO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.16 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|