C33H27NO12 — CID 11192944
hexamethyl 8-phenyl-16-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,10,13-heptaene-10,11,12,13,14,15-hexacarboxylate (PubChem CID 11192944) has the molecular formula C33H27NO12 and a molecular weight of 629.57 g/mol. Its IUPAC name is hexamethyl 8-phenyl-16-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,10,13-heptaene-10,11,12,13,14,15-hexacarboxylate.
| Compound Name | hexamethyl 8-phenyl-16-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,10,13-heptaene-10,11,12,13,14,15-hexacarboxylate |
|---|---|
| PubChem CID | 11192944 |
| Molecular Formula | C33H27NO12 |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | hexamethyl 8-phenyl-16-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,10,13-heptaene-10,11,12,13,14,15-hexacarboxylate |
| SMILES | COC(=O)C1=C2c3ccccc3C(c3ccccc3)=C3C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)(C(C(=O)OC)=C1C(=O)OC)N32 |
| InChI | InChI=1S/C33H27NO12/c1-41-27(35)20-21(28(36)42-2)25-18-15-11-10-14-17(18)19(16-12-8-7-9-13-16)26-22(29(37)43-3)24(31(39)45-5)33(34(25)26,32(40)46-6)23(20)30(38)44-4/h7-15H,1-6H3 |
| InChIKey | AWCTUFKIUVXPAY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|