C22H22O10 — CID 10252976
pentamethyl 4-benzylcyclopenta-2,4-diene-1,1,2,3,5-pentacarboxylate (PubChem CID 10252976) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is pentamethyl 4-benzylcyclopenta-2,4-diene-1,1,2,3,5-pentacarboxylate.
| Compound Name | pentamethyl 4-benzylcyclopenta-2,4-diene-1,1,2,3,5-pentacarboxylate |
|---|---|
| PubChem CID | 10252976 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | pentamethyl 4-benzylcyclopenta-2,4-diene-1,1,2,3,5-pentacarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)(C(=O)OC)C(C(=O)OC)=C1Cc1ccccc1 |
| InChI | InChI=1S/C22H22O10/c1-28-17(23)14-13(11-12-9-7-6-8-10-12)15(18(24)29-2)22(20(26)31-4,21(27)32-5)16(14)19(25)30-3/h6-10H,11H2,1-5H3 |
| InChIKey | DNXPJTKEVQYXLB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|