C21H20INO10 — CID 4863313
pentamethyl 5-(4-iodoanilino)cyclopenta-2,4-diene-1,1,2,3,4-pentacarboxylate (PubChem CID 4863313) has the molecular formula C21H20INO10 and a molecular weight of 573.29 g/mol. Its IUPAC name is pentamethyl 5-(4-iodoanilino)cyclopenta-2,4-diene-1,1,2,3,4-pentacarboxylate.
| Compound Name | pentamethyl 5-(4-iodoanilino)cyclopenta-2,4-diene-1,1,2,3,4-pentacarboxylate |
|---|---|
| PubChem CID | 4863313 |
| Molecular Formula | C21H20INO10 |
| Molecular Weight | 573.29 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | pentamethyl 5-(4-iodoanilino)cyclopenta-2,4-diene-1,1,2,3,4-pentacarboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(I)cc2)C(C(=O)OC)(C(=O)OC)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C21H20INO10/c1-29-16(24)12-13(17(25)30-2)15(23-11-8-6-10(22)7-9-11)21(19(27)32-4,20(28)33-5)14(12)18(26)31-3/h6-9,23H,1-5H3 |
| InChIKey | ZGRFOQLGOKLGCQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|