C24H21NO2 — CID 11834966
methyl 1,3,4-triphenyl-2,3-dihydropyrrole-5-carboxylate (PubChem CID 11834966) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 1,3,4-triphenyl-2,3-dihydropyrrole-5-carboxylate.
| Compound Name | methyl 1,3,4-triphenyl-2,3-dihydropyrrole-5-carboxylate |
|---|---|
| PubChem CID | 11834966 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl 1,3,4-triphenyl-2,3-dihydropyrrole-5-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)C(c2ccccc2)CN1c1ccccc1 |
| InChI | InChI=1S/C24H21NO2/c1-27-24(26)23-22(19-13-7-3-8-14-19)21(18-11-5-2-6-12-18)17-25(23)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3 |
| InChIKey | UNOMEGDBPZQJGZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |