C17H21N2O4+ — CID 101070076
dimethyl 2-[(7aS)-2-phenyl-1,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-3-ylidene]propanedioate (PubChem CID 101070076) has the molecular formula C17H21N2O4+ and a molecular weight of 317.37 g/mol. Its IUPAC name is dimethyl 2-[(7aS)-2-phenyl-1,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-3-ylidene]propanedioate.
| Compound Name | dimethyl 2-[(7aS)-2-phenyl-1,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-3-ylidene]propanedioate |
|---|---|
| PubChem CID | 101070076 |
| Molecular Formula | C17H21N2O4+ |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | dimethyl 2-[(7aS)-2-phenyl-1,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-3-ylidene]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)=C1N(c2ccccc2)C[C@@H]2CCC[NH+]12 |
| InChI | InChI=1S/C17H20N2O4/c1-22-16(20)14(17(21)23-2)15-18-10-6-9-13(18)11-19(15)12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | VGYHOTXLDHGXLL-ZDUSSCGKSA-O |
| XLogP | 0.11 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|