C18H18N4O2 — CID 137292229
methyl 2-diazo-2-(1,3-diphenylimidazolidin-2-yl)acetate (PubChem CID 137292229) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is methyl 2-diazo-2-(1,3-diphenylimidazolidin-2-yl)acetate.
| Compound Name | methyl 2-diazo-2-(1,3-diphenylimidazolidin-2-yl)acetate |
|---|---|
| PubChem CID | 137292229 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl 2-diazo-2-(1,3-diphenylimidazolidin-2-yl)acetate |
| SMILES | COC(=O)C(=[N+]=[N-])C1N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2/c1-24-18(23)16(20-19)17-21(14-8-4-2-5-9-14)12-13-22(17)15-10-6-3-7-11-15/h2-11,17H,12-13H2,1H3 |
| InChIKey | LLSZTDILDGVFHV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|